About (5-methyl-1,2-oxazol-3-yl)-(4-phenylpiperazin-1-yl)methanone
(5-methyl-1,2-oxazol-3-yl)-(4-phenylpiperazin-1-yl)methanone (PubChem CID 3245439) has the molecular formula C15H17N3O2
and a molecular weight of 271.32 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl)-(4-phenylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | (5-methyl-1,2-oxazol-3-yl)-(4-phenylpiperazin-1-yl)methanone |
| PubChem CID | 3245439 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | (5-methyl-1,2-oxazol-3-yl)-(4-phenylpiperazin-1-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCN(c3ccccc3)CC2)no1 |
| InChI | InChI=1S/C15H17N3O2/c1-12-11-14(16-20-12)15(19)18-9-7-17(8-10-18)13-5-3-2-4-6-13/h2-6,11H,7-10H2,1H3 |
| InChIKey | UZTXSECZYQKXHT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-methyl-1,2-oxazol-3-yl)-(4-phenylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1,2-oxazol-3-yl)-(4-phenylpiperazin-1-yl)methanone?
The IUPAC name of (5-methyl-1,2-oxazol-3-yl)-(4-phenylpiperazin-1-yl)methanone (CID 3245439) is (5-methyl-1,2-oxazol-3-yl)-(4-phenylpiperazin-1-yl)methanone.
What is the SMILES notation for (5-methyl-1,2-oxazol-3-yl)-(4-phenylpiperazin-1-yl)methanone?
The canonical SMILES for (5-methyl-1,2-oxazol-3-yl)-(4-phenylpiperazin-1-yl)methanone is Cc1cc(C(=O)N2CCN(c3ccccc3)CC2)no1.
What is the InChIKey of (5-methyl-1,2-oxazol-3-yl)-(4-phenylpiperazin-1-yl)methanone?
The InChIKey is UZTXSECZYQKXHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O2/c1-12-11-14(16-20-12)15(19)18-9-7-17(8-10-18)13-5-3-2-4-6-13/h2-6,11H,7-10H2,1H3.
What are the key properties of (5-methyl-1,2-oxazol-3-yl)-(4-phenylpiperazin-1-yl)methanone?
(5-methyl-1,2-oxazol-3-yl)-(4-phenylpiperazin-1-yl)methanone has a molecular weight of 271.32 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1,2-oxazol-3-yl)-(4-phenylpiperazin-1-yl)methanone is sourced from PubChem (CID 3245439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).