About 2-[4-(2-hydroxyphenyl)-6-methylsulfanyl-1,3,5-triazin-2-yl]phenol
2-[4-(2-hydroxyphenyl)-6-methylsulfanyl-1,3,5-triazin-2-yl]phenol (PubChem CID 3245651) has the molecular formula C16H13N3O2S
and a molecular weight of 311.37 g/mol. Its IUPAC name is 2-[4-(2-hydroxyphenyl)-6-methylsulfanyl-1,3,5-triazin-2-yl]phenol.
Molecular Properties
| Compound Name | 2-[4-(2-hydroxyphenyl)-6-methylsulfanyl-1,3,5-triazin-2-yl]phenol |
| PubChem CID | 3245651 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-[4-(2-hydroxyphenyl)-6-methylsulfanyl-1,3,5-triazin-2-yl]phenol |
| SMILES | CSc1nc(-c2ccccc2O)nc(-c2ccccc2O)n1 |
| InChI | InChI=1S/C16H13N3O2S/c1-22-16-18-14(10-6-2-4-8-12(10)20)17-15(19-16)11-7-3-5-9-13(11)21/h2-9,20-21H,1H3 |
| InChIKey | QZDDWFSYSTWNEL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-(2-hydroxyphenyl)-6-methylsulfanyl-1,3,5-triazin-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-hydroxyphenyl)-6-methylsulfanyl-1,3,5-triazin-2-yl]phenol?
The IUPAC name of 2-[4-(2-hydroxyphenyl)-6-methylsulfanyl-1,3,5-triazin-2-yl]phenol (CID 3245651) is 2-[4-(2-hydroxyphenyl)-6-methylsulfanyl-1,3,5-triazin-2-yl]phenol.
What is the SMILES notation for 2-[4-(2-hydroxyphenyl)-6-methylsulfanyl-1,3,5-triazin-2-yl]phenol?
The canonical SMILES for 2-[4-(2-hydroxyphenyl)-6-methylsulfanyl-1,3,5-triazin-2-yl]phenol is CSc1nc(-c2ccccc2O)nc(-c2ccccc2O)n1.
What is the InChIKey of 2-[4-(2-hydroxyphenyl)-6-methylsulfanyl-1,3,5-triazin-2-yl]phenol?
The InChIKey is QZDDWFSYSTWNEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O2S/c1-22-16-18-14(10-6-2-4-8-12(10)20)17-15(19-16)11-7-3-5-9-13(11)21/h2-9,20-21H,1H3.
What are the key properties of 2-[4-(2-hydroxyphenyl)-6-methylsulfanyl-1,3,5-triazin-2-yl]phenol?
2-[4-(2-hydroxyphenyl)-6-methylsulfanyl-1,3,5-triazin-2-yl]phenol has a molecular weight of 311.37 g/mol, XLogP of 3.34, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-hydroxyphenyl)-6-methylsulfanyl-1,3,5-triazin-2-yl]phenol is sourced from PubChem (CID 3245651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).