C22H24N4O2S — CID 3245726
1-ethyl-4-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]sulfanylquinolin-2-one (PubChem CID 3245726) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is 1-ethyl-4-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]sulfanylquinolin-2-one.
| Compound Name | 1-ethyl-4-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]sulfanylquinolin-2-one |
|---|---|
| PubChem CID | 3245726 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 1-ethyl-4-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]sulfanylquinolin-2-one |
| SMILES | CCn1c(=O)cc(SCC(=O)N2CCN(c3ccccn3)CC2)c2ccccc21 |
| InChI | InChI=1S/C22H24N4O2S/c1-2-26-18-8-4-3-7-17(18)19(15-21(26)27)29-16-22(28)25-13-11-24(12-14-25)20-9-5-6-10-23-20/h3-10,15H,2,11-14,16H2,1H3 |
| InChIKey | UJJHJRHJIBQXFD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |