About N,N-dicyclohexyl-5-methyl-1,2-oxazole-3-carboxamide
N,N-dicyclohexyl-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 3245758) has the molecular formula C17H26N2O2
and a molecular weight of 290.41 g/mol. Its IUPAC name is N,N-dicyclohexyl-5-methyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N,N-dicyclohexyl-5-methyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 3245758 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | N,N-dicyclohexyl-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C2CCCCC2)C2CCCCC2)no1 |
| InChI | InChI=1S/C17H26N2O2/c1-13-12-16(18-21-13)17(20)19(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h12,14-15H,2-11H2,1H3 |
| InChIKey | ACAPZKCRDPYIJW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dicyclohexyl-5-methyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dicyclohexyl-5-methyl-1,2-oxazole-3-carboxamide?
The IUPAC name of N,N-dicyclohexyl-5-methyl-1,2-oxazole-3-carboxamide (CID 3245758) is N,N-dicyclohexyl-5-methyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N,N-dicyclohexyl-5-methyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for N,N-dicyclohexyl-5-methyl-1,2-oxazole-3-carboxamide is Cc1cc(C(=O)N(C2CCCCC2)C2CCCCC2)no1.
What is the InChIKey of N,N-dicyclohexyl-5-methyl-1,2-oxazole-3-carboxamide?
The InChIKey is ACAPZKCRDPYIJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O2/c1-13-12-16(18-21-13)17(20)19(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h12,14-15H,2-11H2,1H3.
What are the key properties of N,N-dicyclohexyl-5-methyl-1,2-oxazole-3-carboxamide?
N,N-dicyclohexyl-5-methyl-1,2-oxazole-3-carboxamide has a molecular weight of 290.41 g/mol, XLogP of 4.09, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dicyclohexyl-5-methyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 3245758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).