About 4-N-benzyl-3-N-(4-chlorophenyl)-1,1-dioxothiolane-3,4-diamine
4-N-benzyl-3-N-(4-chlorophenyl)-1,1-dioxothiolane-3,4-diamine (PubChem CID 3245919) has the molecular formula C17H19ClN2O2S
and a molecular weight of 350.87 g/mol. Its IUPAC name is 4-N-benzyl-3-N-(4-chlorophenyl)-1,1-dioxothiolane-3,4-diamine.
Molecular Properties
| Compound Name | 4-N-benzyl-3-N-(4-chlorophenyl)-1,1-dioxothiolane-3,4-diamine |
| PubChem CID | 3245919 |
| Molecular Formula | C17H19ClN2O2S |
| Molecular Weight | 350.87 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 4-N-benzyl-3-N-(4-chlorophenyl)-1,1-dioxothiolane-3,4-diamine |
| SMILES | O=S1(=O)CC(NCc2ccccc2)C(Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C17H19ClN2O2S/c18-14-6-8-15(9-7-14)20-17-12-23(21,22)11-16(17)19-10-13-4-2-1-3-5-13/h1-9,16-17,19-20H,10-12H2 |
| InChIKey | UIVOXURRYWHGRC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.87 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-N-benzyl-3-N-(4-chlorophenyl)-1,1-dioxothiolane-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-benzyl-3-N-(4-chlorophenyl)-1,1-dioxothiolane-3,4-diamine?
The IUPAC name of 4-N-benzyl-3-N-(4-chlorophenyl)-1,1-dioxothiolane-3,4-diamine (CID 3245919) is 4-N-benzyl-3-N-(4-chlorophenyl)-1,1-dioxothiolane-3,4-diamine.
What is the SMILES notation for 4-N-benzyl-3-N-(4-chlorophenyl)-1,1-dioxothiolane-3,4-diamine?
The canonical SMILES for 4-N-benzyl-3-N-(4-chlorophenyl)-1,1-dioxothiolane-3,4-diamine is O=S1(=O)CC(NCc2ccccc2)C(Nc2ccc(Cl)cc2)C1.
What is the InChIKey of 4-N-benzyl-3-N-(4-chlorophenyl)-1,1-dioxothiolane-3,4-diamine?
The InChIKey is UIVOXURRYWHGRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19ClN2O2S/c18-14-6-8-15(9-7-14)20-17-12-23(21,22)11-16(17)19-10-13-4-2-1-3-5-13/h1-9,16-17,19-20H,10-12H2.
What are the key properties of 4-N-benzyl-3-N-(4-chlorophenyl)-1,1-dioxothiolane-3,4-diamine?
4-N-benzyl-3-N-(4-chlorophenyl)-1,1-dioxothiolane-3,4-diamine has a molecular weight of 350.87 g/mol, XLogP of 2.71, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-benzyl-3-N-(4-chlorophenyl)-1,1-dioxothiolane-3,4-diamine is sourced from PubChem (CID 3245919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).