C8H14O8 — CID 3246005
(3S,4S,5S)-3,4-dihydroxy-5-[(1R,2R,3R)-1,2,3,4-tetrahydroxybutyl]oxolan-2-one (PubChem CID 3246005) has the molecular formula C8H14O8 and a molecular weight of 238.19 g/mol. Its IUPAC name is (3S,4S,5S)-3,4-dihydroxy-5-[(1R,2R,3R)-1,2,3,4-tetrahydroxybutyl]oxolan-2-one.
| Compound Name | (3S,4S,5S)-3,4-dihydroxy-5-[(1R,2R,3R)-1,2,3,4-tetrahydroxybutyl]oxolan-2-one |
|---|---|
| PubChem CID | 3246005 |
| Molecular Formula | C8H14O8 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | (3S,4S,5S)-3,4-dihydroxy-5-[(1R,2R,3R)-1,2,3,4-tetrahydroxybutyl]oxolan-2-one |
| SMILES | O=C1O[C@@H]([C@H](O)[C@H](O)[C@H](O)CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H14O8/c9-1-2(10)3(11)4(12)7-5(13)6(14)8(15)16-7/h2-7,9-14H,1H2/t2-,3-,4-,5+,6+,7+/m1/s1 |
| InChIKey | NUYDBDGECBIUPJ-MAFUWASYSA-N |
| XLogP | -4.29 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | -4.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |