C24H24Cl4N2+2 — CID 3246015
1-[(3,4-dichlorophenyl)methyl]-3-[(1S,2R)-1-[(3,4-dichlorophenyl)methyl]-1-methylpyrrolidin-1-ium-2-yl]pyridin-1-ium (PubChem CID 3246015) has the molecular formula C24H24Cl4N2+2 and a molecular weight of 482.28 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-[(1S,2R)-1-[(3,4-dichlorophenyl)methyl]-1-methylpyrrolidin-1-ium-2-yl]pyridin-1-ium.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-[(1S,2R)-1-[(3,4-dichlorophenyl)methyl]-1-methylpyrrolidin-1-ium-2-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 3246015 |
| Molecular Formula | C24H24Cl4N2+2 |
| Molecular Weight | 482.28 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-[(1S,2R)-1-[(3,4-dichlorophenyl)methyl]-1-methylpyrrolidin-1-ium-2-yl]pyridin-1-ium |
| SMILES | C[N@@+]1(Cc2ccc(Cl)c(Cl)c2)CCC[C@@H]1c1ccc[n+](Cc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C24H24Cl4N2/c1-30(16-18-7-9-21(26)23(28)13-18)11-3-5-24(30)19-4-2-10-29(15-19)14-17-6-8-20(25)22(27)12-17/h2,4,6-10,12-13,15,24H,3,5,11,14,16H2,1H3/q+2/t24-,30+/m1/s1 |
| InChIKey | KMLZVZXTJRRFSZ-HLADLETHSA-N |
| XLogP | 7.12 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.28 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|