C29H33FO6 — CID 3246136
(1S,2R,4R,6S,8R,9S,11R,12S,13R)-12-fluoro-11-hydroxy-8-(2-hydroxyacetyl)-6,9,13-trimethyl-6-phenyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one (PubChem CID 3246136) has the molecular formula C29H33FO6 and a molecular weight of 496.58 g/mol. Its IUPAC name is (1S,2R,4R,6S,8R,9S,11R,12S,13R)-12-fluoro-11-hydroxy-8-(2-hydroxyacetyl)-6,9,13-trimethyl-6-phenyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one.
| Compound Name | (1S,2R,4R,6S,8R,9S,11R,12S,13R)-12-fluoro-11-hydroxy-8-(2-hydroxyacetyl)-6,9,13-trimethyl-6-phenyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
|---|---|
| PubChem CID | 3246136 |
| Molecular Formula | C29H33FO6 |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | (1S,2R,4R,6S,8R,9S,11R,12S,13R)-12-fluoro-11-hydroxy-8-(2-hydroxyacetyl)-6,9,13-trimethyl-6-phenyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| SMILES | C[C@]1(c2ccccc2)O[C@@H]2C[C@@H]3[C@@H]4CCC5=CC(=O)C=C[C@@]5(C)[C@]4(F)[C@H](O)C[C@]3(C)[C@@]2(C(=O)CO)O1 |
| InChI | InChI=1S/C29H33FO6/c1-25-12-11-19(32)13-18(25)9-10-20-21-14-24-29(23(34)16-31,26(21,2)15-22(33)28(20,25)30)36-27(3,35-24)17-7-5-4-6-8-17/h4-8,11-13,20-22,24,31,33H,9-10,14-16H2,1-3H3/t20-,21+,22+,24+,25+,26-,27-,28+,29-/m0/s1 |
| InChIKey | HCKFPALGXKOOBK-STIMILSPSA-N |
| XLogP | 3.56 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |