3-[(4S)-2,5-dioxo-4-phenylimidazolidin-4-yl]propanoic acid

C12H12N2O4 — CID 3246142

IUPAC3-[(4S)-2,5-dioxo-4-phenylimidazolidin-4-yl]propanoic acid
SMILESO=C(O)CC[C@@]1(c2ccccc2)NC(=O)NC1=O
InChIInChI=1S/C12H12N2O4/c15-9(16)6-7-12(8-4-2-1-3-5-8)10(17)13-11(18)14-12/h1-5H,6-7H2,(H,15,16)(H2,13,14,17,18)/t12-/m0/s1
InChIKeyRUWPCCQWDIAGAJ-LBPRGKRZSA-N
MW248.24 g/mol
LogP0.59
Rot. Bonds4

About 3-[(4S)-2,5-dioxo-4-phenylimidazolidin-4-yl]propanoic acid

3-[(4S)-2,5-dioxo-4-phenylimidazolidin-4-yl]propanoic acid (PubChem CID 3246142) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 3-[(4S)-2,5-dioxo-4-phenylimidazolidin-4-yl]propanoic acid.

Molecular Properties

Compound Name3-[(4S)-2,5-dioxo-4-phenylimidazolidin-4-yl]propanoic acid
PubChem CID3246142
Molecular FormulaC12H12N2O4
Molecular Weight248.24 g/mol
Exact Mass248.08
IUPAC Name3-[(4S)-2,5-dioxo-4-phenylimidazolidin-4-yl]propanoic acid
SMILESO=C(O)CC[C@@]1(c2ccccc2)NC(=O)NC1=O
InChIInChI=1S/C12H12N2O4/c15-9(16)6-7-12(8-4-2-1-3-5-8)10(17)13-11(18)14-12/h1-5H,6-7H2,(H,15,16)(H2,13,14,17,18)/t12-/m0/s1
InChIKeyRUWPCCQWDIAGAJ-LBPRGKRZSA-N
XLogP0.59
TPSA95.50 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.24
LogP ≤ 50.59
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydantoin', 'substructure': 'N/A'}

Analyze 3-[(4S)-2,5-dioxo-4-phenylimidazolidin-4-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(4S)-2,5-dioxo-4-phenylimidazolidin-4-yl]propanoic acid?
The IUPAC name of 3-[(4S)-2,5-dioxo-4-phenylimidazolidin-4-yl]propanoic acid (CID 3246142) is 3-[(4S)-2,5-dioxo-4-phenylimidazolidin-4-yl]propanoic acid.
What is the SMILES notation for 3-[(4S)-2,5-dioxo-4-phenylimidazolidin-4-yl]propanoic acid?
The canonical SMILES for 3-[(4S)-2,5-dioxo-4-phenylimidazolidin-4-yl]propanoic acid is O=C(O)CC[C@@]1(c2ccccc2)NC(=O)NC1=O.
What is the InChIKey of 3-[(4S)-2,5-dioxo-4-phenylimidazolidin-4-yl]propanoic acid?
The InChIKey is RUWPCCQWDIAGAJ-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H12N2O4/c15-9(16)6-7-12(8-4-2-1-3-5-8)10(17)13-11(18)14-12/h1-5H,6-7H2,(H,15,16)(H2,13,14,17,18)/t12-/m0/s1.
What are the key properties of 3-[(4S)-2,5-dioxo-4-phenylimidazolidin-4-yl]propanoic acid?
3-[(4S)-2,5-dioxo-4-phenylimidazolidin-4-yl]propanoic acid has a molecular weight of 248.24 g/mol, XLogP of 0.59, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4S)-2,5-dioxo-4-phenylimidazolidin-4-yl]propanoic acid is sourced from PubChem (CID 3246142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).