About (2R)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-[(3R)-3-methylpiperidin-1-yl]propan-2-ol
(2R)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-[(3R)-3-methylpiperidin-1-yl]propan-2-ol (PubChem CID 3246247) has the molecular formula C18H28N2O
and a molecular weight of 288.43 g/mol. Its IUPAC name is (2R)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-[(3R)-3-methylpiperidin-1-yl]propan-2-ol.
Molecular Properties
| Compound Name | (2R)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-[(3R)-3-methylpiperidin-1-yl]propan-2-ol |
| PubChem CID | 3246247 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | (2R)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-[(3R)-3-methylpiperidin-1-yl]propan-2-ol |
| SMILES | C[C@@H]1CCCN(C[C@@H](O)CN2CCCc3ccccc32)C1 |
| InChI | InChI=1S/C18H28N2O/c1-15-6-4-10-19(12-15)13-17(21)14-20-11-5-8-16-7-2-3-9-18(16)20/h2-3,7,9,15,17,21H,4-6,8,10-14H2,1H3/t15-,17-/m1/s1 |
| InChIKey | VOGJJIQUEMRFQF-NVXWUHKLSA-N |
| XLogP | 2.53 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-[(3R)-3-methylpiperidin-1-yl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-[(3R)-3-methylpiperidin-1-yl]propan-2-ol?
The IUPAC name of (2R)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-[(3R)-3-methylpiperidin-1-yl]propan-2-ol (CID 3246247) is (2R)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-[(3R)-3-methylpiperidin-1-yl]propan-2-ol.
What is the SMILES notation for (2R)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-[(3R)-3-methylpiperidin-1-yl]propan-2-ol?
The canonical SMILES for (2R)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-[(3R)-3-methylpiperidin-1-yl]propan-2-ol is C[C@@H]1CCCN(C[C@@H](O)CN2CCCc3ccccc32)C1.
What is the InChIKey of (2R)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-[(3R)-3-methylpiperidin-1-yl]propan-2-ol?
The InChIKey is VOGJJIQUEMRFQF-NVXWUHKLSA-N. The full InChI is InChI=1S/C18H28N2O/c1-15-6-4-10-19(12-15)13-17(21)14-20-11-5-8-16-7-2-3-9-18(16)20/h2-3,7,9,15,17,21H,4-6,8,10-14H2,1H3/t15-,17-/m1/s1.
What are the key properties of (2R)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-[(3R)-3-methylpiperidin-1-yl]propan-2-ol?
(2R)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-[(3R)-3-methylpiperidin-1-yl]propan-2-ol has a molecular weight of 288.43 g/mol, XLogP of 2.53, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(3,4-dihydro-2H-quinolin-1-yl)-3-[(3R)-3-methylpiperidin-1-yl]propan-2-ol is sourced from PubChem (CID 3246247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).