About 3-[(10S)-3,10-dimethyl-3-azoniaspiro[5.5]undecan-3-yl]propyl-trimethylazanium
3-[(10S)-3,10-dimethyl-3-azoniaspiro[5.5]undecan-3-yl]propyl-trimethylazanium (PubChem CID 3246352) has the molecular formula C18H38N2+2
and a molecular weight of 282.52 g/mol. Its IUPAC name is 3-[(10S)-3,10-dimethyl-3-azoniaspiro[5.5]undecan-3-yl]propyl-trimethylazanium.
Molecular Properties
| Compound Name | 3-[(10S)-3,10-dimethyl-3-azoniaspiro[5.5]undecan-3-yl]propyl-trimethylazanium |
| PubChem CID | 3246352 |
| Molecular Formula | C18H38N2+2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.30 |
| IUPAC Name | 3-[(10S)-3,10-dimethyl-3-azoniaspiro[5.5]undecan-3-yl]propyl-trimethylazanium |
| SMILES | C[C@H]1CCCC2(CC[N+](C)(CCC[N+](C)(C)C)CC2)C1 |
| InChI | InChI=1S/C18H38N2/c1-17-8-6-9-18(16-17)10-14-20(5,15-11-18)13-7-12-19(2,3)4/h17H,6-16H2,1-5H3/q+2/t17-,18?,20?/m0/s1 |
| InChIKey | ONJNGXXZZLUSKY-ZJRDLVKKSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[(10S)-3,10-dimethyl-3-azoniaspiro[5.5]undecan-3-yl]propyl-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(10S)-3,10-dimethyl-3-azoniaspiro[5.5]undecan-3-yl]propyl-trimethylazanium?
The IUPAC name of 3-[(10S)-3,10-dimethyl-3-azoniaspiro[5.5]undecan-3-yl]propyl-trimethylazanium (CID 3246352) is 3-[(10S)-3,10-dimethyl-3-azoniaspiro[5.5]undecan-3-yl]propyl-trimethylazanium.
What is the SMILES notation for 3-[(10S)-3,10-dimethyl-3-azoniaspiro[5.5]undecan-3-yl]propyl-trimethylazanium?
The canonical SMILES for 3-[(10S)-3,10-dimethyl-3-azoniaspiro[5.5]undecan-3-yl]propyl-trimethylazanium is C[C@H]1CCCC2(CC[N+](C)(CCC[N+](C)(C)C)CC2)C1.
What is the InChIKey of 3-[(10S)-3,10-dimethyl-3-azoniaspiro[5.5]undecan-3-yl]propyl-trimethylazanium?
The InChIKey is ONJNGXXZZLUSKY-ZJRDLVKKSA-N. The full InChI is InChI=1S/C18H38N2/c1-17-8-6-9-18(16-17)10-14-20(5,15-11-18)13-7-12-19(2,3)4/h17H,6-16H2,1-5H3/q+2/t17-,18?,20?/m0/s1.
What are the key properties of 3-[(10S)-3,10-dimethyl-3-azoniaspiro[5.5]undecan-3-yl]propyl-trimethylazanium?
3-[(10S)-3,10-dimethyl-3-azoniaspiro[5.5]undecan-3-yl]propyl-trimethylazanium has a molecular weight of 282.52 g/mol, XLogP of 3.52, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(10S)-3,10-dimethyl-3-azoniaspiro[5.5]undecan-3-yl]propyl-trimethylazanium is sourced from PubChem (CID 3246352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).