About 2-[(5S)-2,4-dioxo-5-phenyl-1,3-oxazolidin-3-yl]acetic acid
2-[(5S)-2,4-dioxo-5-phenyl-1,3-oxazolidin-3-yl]acetic acid (PubChem CID 3246410) has the molecular formula C11H9NO5
and a molecular weight of 235.19 g/mol. Its IUPAC name is 2-[(5S)-2,4-dioxo-5-phenyl-1,3-oxazolidin-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(5S)-2,4-dioxo-5-phenyl-1,3-oxazolidin-3-yl]acetic acid |
| PubChem CID | 3246410 |
| Molecular Formula | C11H9NO5 |
| Molecular Weight | 235.19 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 2-[(5S)-2,4-dioxo-5-phenyl-1,3-oxazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)O[C@@H](c2ccccc2)C1=O |
| InChI | InChI=1S/C11H9NO5/c13-8(14)6-12-10(15)9(17-11(12)16)7-4-2-1-3-5-7/h1-5,9H,6H2,(H,13,14)/t9-/m0/s1 |
| InChIKey | BOCMLQYREYMDBY-VIFPVBQESA-N |
| XLogP | 0.79 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(5S)-2,4-dioxo-5-phenyl-1,3-oxazolidin-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5S)-2,4-dioxo-5-phenyl-1,3-oxazolidin-3-yl]acetic acid?
The IUPAC name of 2-[(5S)-2,4-dioxo-5-phenyl-1,3-oxazolidin-3-yl]acetic acid (CID 3246410) is 2-[(5S)-2,4-dioxo-5-phenyl-1,3-oxazolidin-3-yl]acetic acid.
What is the SMILES notation for 2-[(5S)-2,4-dioxo-5-phenyl-1,3-oxazolidin-3-yl]acetic acid?
The canonical SMILES for 2-[(5S)-2,4-dioxo-5-phenyl-1,3-oxazolidin-3-yl]acetic acid is O=C(O)CN1C(=O)O[C@@H](c2ccccc2)C1=O.
What is the InChIKey of 2-[(5S)-2,4-dioxo-5-phenyl-1,3-oxazolidin-3-yl]acetic acid?
The InChIKey is BOCMLQYREYMDBY-VIFPVBQESA-N. The full InChI is InChI=1S/C11H9NO5/c13-8(14)6-12-10(15)9(17-11(12)16)7-4-2-1-3-5-7/h1-5,9H,6H2,(H,13,14)/t9-/m0/s1.
What are the key properties of 2-[(5S)-2,4-dioxo-5-phenyl-1,3-oxazolidin-3-yl]acetic acid?
2-[(5S)-2,4-dioxo-5-phenyl-1,3-oxazolidin-3-yl]acetic acid has a molecular weight of 235.19 g/mol, XLogP of 0.79, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5S)-2,4-dioxo-5-phenyl-1,3-oxazolidin-3-yl]acetic acid is sourced from PubChem (CID 3246410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).