C23H30O3S — CID 3246441
[(1S,2R,5S)-5-tert-butyl-2-phenylcyclohexyl] 4-methylbenzenesulfonate (PubChem CID 3246441) has the molecular formula C23H30O3S and a molecular weight of 386.56 g/mol. Its IUPAC name is [(1S,2R,5S)-5-tert-butyl-2-phenylcyclohexyl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,2R,5S)-5-tert-butyl-2-phenylcyclohexyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 3246441 |
| Molecular Formula | C23H30O3S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | [(1S,2R,5S)-5-tert-butyl-2-phenylcyclohexyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2C[C@@H](C(C)(C)C)CC[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H30O3S/c1-17-10-13-20(14-11-17)27(24,25)26-22-16-19(23(2,3)4)12-15-21(22)18-8-6-5-7-9-18/h5-11,13-14,19,21-22H,12,15-16H2,1-4H3/t19-,21+,22-/m0/s1 |
| InChIKey | MONPOCASPAGPNP-NNWRFLSQSA-N |
| XLogP | 5.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|