About 2-[(1R)-1-(1,3-benzodioxol-5-yl)-2-nitroethyl]sulfanylaniline
2-[(1R)-1-(1,3-benzodioxol-5-yl)-2-nitroethyl]sulfanylaniline (PubChem CID 3246673) has the molecular formula C15H14N2O4S
and a molecular weight of 318.35 g/mol. Its IUPAC name is 2-[(1R)-1-(1,3-benzodioxol-5-yl)-2-nitroethyl]sulfanylaniline.
Molecular Properties
| Compound Name | 2-[(1R)-1-(1,3-benzodioxol-5-yl)-2-nitroethyl]sulfanylaniline |
| PubChem CID | 3246673 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-[(1R)-1-(1,3-benzodioxol-5-yl)-2-nitroethyl]sulfanylaniline |
| SMILES | Nc1ccccc1S[C@@H](C[N+](=O)[O-])c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H14N2O4S/c16-11-3-1-2-4-14(11)22-15(8-17(18)19)10-5-6-12-13(7-10)21-9-20-12/h1-7,15H,8-9,16H2/t15-/m0/s1 |
| InChIKey | GOZMYDAYGPERLQ-HNNXBMFYSA-N |
| XLogP | 3.11 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R)-1-(1,3-benzodioxol-5-yl)-2-nitroethyl]sulfanylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R)-1-(1,3-benzodioxol-5-yl)-2-nitroethyl]sulfanylaniline?
The IUPAC name of 2-[(1R)-1-(1,3-benzodioxol-5-yl)-2-nitroethyl]sulfanylaniline (CID 3246673) is 2-[(1R)-1-(1,3-benzodioxol-5-yl)-2-nitroethyl]sulfanylaniline.
What is the SMILES notation for 2-[(1R)-1-(1,3-benzodioxol-5-yl)-2-nitroethyl]sulfanylaniline?
The canonical SMILES for 2-[(1R)-1-(1,3-benzodioxol-5-yl)-2-nitroethyl]sulfanylaniline is Nc1ccccc1S[C@@H](C[N+](=O)[O-])c1ccc2c(c1)OCO2.
What is the InChIKey of 2-[(1R)-1-(1,3-benzodioxol-5-yl)-2-nitroethyl]sulfanylaniline?
The InChIKey is GOZMYDAYGPERLQ-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H14N2O4S/c16-11-3-1-2-4-14(11)22-15(8-17(18)19)10-5-6-12-13(7-10)21-9-20-12/h1-7,15H,8-9,16H2/t15-/m0/s1.
What are the key properties of 2-[(1R)-1-(1,3-benzodioxol-5-yl)-2-nitroethyl]sulfanylaniline?
2-[(1R)-1-(1,3-benzodioxol-5-yl)-2-nitroethyl]sulfanylaniline has a molecular weight of 318.35 g/mol, XLogP of 3.11, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R)-1-(1,3-benzodioxol-5-yl)-2-nitroethyl]sulfanylaniline is sourced from PubChem (CID 3246673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).