About (2R)-2,4-bis(1H-indol-3-yl)butan-1-ol
(2R)-2,4-bis(1H-indol-3-yl)butan-1-ol (PubChem CID 3246676) has the molecular formula C20H20N2O
and a molecular weight of 304.39 g/mol. Its IUPAC name is (2R)-2,4-bis(1H-indol-3-yl)butan-1-ol.
Molecular Properties
| Compound Name | (2R)-2,4-bis(1H-indol-3-yl)butan-1-ol |
| PubChem CID | 3246676 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (2R)-2,4-bis(1H-indol-3-yl)butan-1-ol |
| SMILES | OC[C@H](CCc1c[nH]c2ccccc12)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H20N2O/c23-13-15(18-12-22-20-8-4-2-6-17(18)20)10-9-14-11-21-19-7-3-1-5-16(14)19/h1-8,11-12,15,21-23H,9-10,13H2/t15-/m0/s1 |
| InChIKey | WGBUYPUFZUPNQF-HNNXBMFYSA-N |
| XLogP | 4.36 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-2,4-bis(1H-indol-3-yl)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2,4-bis(1H-indol-3-yl)butan-1-ol?
The IUPAC name of (2R)-2,4-bis(1H-indol-3-yl)butan-1-ol (CID 3246676) is (2R)-2,4-bis(1H-indol-3-yl)butan-1-ol.
What is the SMILES notation for (2R)-2,4-bis(1H-indol-3-yl)butan-1-ol?
The canonical SMILES for (2R)-2,4-bis(1H-indol-3-yl)butan-1-ol is OC[C@H](CCc1c[nH]c2ccccc12)c1c[nH]c2ccccc12.
What is the InChIKey of (2R)-2,4-bis(1H-indol-3-yl)butan-1-ol?
The InChIKey is WGBUYPUFZUPNQF-HNNXBMFYSA-N. The full InChI is InChI=1S/C20H20N2O/c23-13-15(18-12-22-20-8-4-2-6-17(18)20)10-9-14-11-21-19-7-3-1-5-16(14)19/h1-8,11-12,15,21-23H,9-10,13H2/t15-/m0/s1.
What are the key properties of (2R)-2,4-bis(1H-indol-3-yl)butan-1-ol?
(2R)-2,4-bis(1H-indol-3-yl)butan-1-ol has a molecular weight of 304.39 g/mol, XLogP of 4.36, 5 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,4-bis(1H-indol-3-yl)butan-1-ol is sourced from PubChem (CID 3246676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).