C28H40N6O6 — CID 3246685
acetic acid;5,12-bis[(4-methylpiperazin-1-yl)methyl]-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone (PubChem CID 3246685) has the molecular formula C28H40N6O6 and a molecular weight of 556.66 g/mol. Its IUPAC name is acetic acid;5,12-bis[(4-methylpiperazin-1-yl)methyl]-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone.
| Compound Name | acetic acid;5,12-bis[(4-methylpiperazin-1-yl)methyl]-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone |
|---|---|
| PubChem CID | 3246685 |
| Molecular Formula | C28H40N6O6 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | acetic acid;5,12-bis[(4-methylpiperazin-1-yl)methyl]-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-ene-4,6,11,13-tetrone |
| SMILES | CC(=O)O.CN1CCN(CN2C(=O)C3C4C=CC(C3C2=O)C2C3C(=O)N(CN5CCN(C)CC5)C(=O)C3C42)CC1 |
| InChI | InChI=1S/C26H36N6O4.C2H4O2/c1-27-5-9-29(10-6-27)13-31-23(33)19-15-3-4-16(20(19)24(31)34)18-17(15)21-22(18)26(36)32(25(21)35)14-30-11-7-28(2)8-12-30;1-2(3)4/h3-4,15-22H,5-14H2,1-2H3;1H3,(H,3,4) |
| InChIKey | XDUQDAZUBUSQSK-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|