About 8-methyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnoline
8-methyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnoline (PubChem CID 3246751) has the molecular formula C9H8N4O
and a molecular weight of 188.19 g/mol. Its IUPAC name is 8-methyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnoline.
Analyze 8-methyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnoline?
The IUPAC name of 8-methyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnoline (CID 3246751) is 8-methyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnoline.
What is the SMILES notation for 8-methyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnoline?
The canonical SMILES for 8-methyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnoline is Cc1cc2c(nn1)CCc1nonc1-2.
What is the InChIKey of 8-methyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnoline?
The InChIKey is XCTGVAZZQSNJFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O/c1-5-4-6-7(11-10-5)2-3-8-9(6)13-14-12-8/h4H,2-3H2,1H3.
What are the key properties of 8-methyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnoline?
8-methyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnoline has a molecular weight of 188.19 g/mol, XLogP of 0.93, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-4,5-dihydro-[1,2,5]oxadiazolo[3,4-f]cinnoline is sourced from PubChem (CID 3246751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).