C11H8N4OS — CID 3246756
3-methylsulfanyl-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 3246756) has the molecular formula C11H8N4OS and a molecular weight of 244.28 g/mol. Its IUPAC name is 3-methylsulfanyl-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | 3-methylsulfanyl-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 3246756 |
| Molecular Formula | C11H8N4OS |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 3-methylsulfanyl-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | CSc1nnc2c(n1)OC=Nc1ccccc1-2 |
| InChI | InChI=1S/C11H8N4OS/c1-17-11-13-10-9(14-15-11)7-4-2-3-5-8(7)12-6-16-10/h2-6H,1H3 |
| InChIKey | XAPFAQBAOMGDOO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 60.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_67_A(1)', 'substructure': 'N/A'} |
|---|