C13H9BrN4OS — CID 3246774
10-bromo-3-prop-2-enylsulfanyl-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 3246774) has the molecular formula C13H9BrN4OS and a molecular weight of 349.21 g/mol. Its IUPAC name is 10-bromo-3-prop-2-enylsulfanyl-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | 10-bromo-3-prop-2-enylsulfanyl-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 3246774 |
| Molecular Formula | C13H9BrN4OS |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 10-bromo-3-prop-2-enylsulfanyl-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | C=CCSc1nnc2c(n1)OC=Nc1ccc(Br)cc1-2 |
| InChI | InChI=1S/C13H9BrN4OS/c1-2-5-20-13-16-12-11(17-18-13)9-6-8(14)3-4-10(9)15-7-19-12/h2-4,6-7H,1,5H2 |
| InChIKey | LHMYFFQVDQVVDO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 60.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_67_A(1)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|