C39H41N3O7 — CID 3247097
methyl (2R,3R,6R)-4-benzoyl-9-[2-(3,4-dihydroxyphenyl)ethyl]-3-[(4-methoxyphenyl)methyl]-10-(pyrrolidine-1-carbonyl)-4,9-diazatricyclo[6.3.0.02,6]undeca-1(8),10-diene-3-carboxylate (PubChem CID 3247097) has the molecular formula C39H41N3O7 and a molecular weight of 663.77 g/mol. Its IUPAC name is methyl (2R,3R,6R)-4-benzoyl-9-[2-(3,4-dihydroxyphenyl)ethyl]-3-[(4-methoxyphenyl)methyl]-10-(pyrrolidine-1-carbonyl)-4,9-diazatricyclo[6.3.0.02,6]undeca-1(8),10-diene-3-carboxylate.
| Compound Name | methyl (2R,3R,6R)-4-benzoyl-9-[2-(3,4-dihydroxyphenyl)ethyl]-3-[(4-methoxyphenyl)methyl]-10-(pyrrolidine-1-carbonyl)-4,9-diazatricyclo[6.3.0.02,6]undeca-1(8),10-diene-3-carboxylate |
|---|---|
| PubChem CID | 3247097 |
| Molecular Formula | C39H41N3O7 |
| Molecular Weight | 663.77 g/mol |
| Exact Mass | 663.29 |
| IUPAC Name | methyl (2R,3R,6R)-4-benzoyl-9-[2-(3,4-dihydroxyphenyl)ethyl]-3-[(4-methoxyphenyl)methyl]-10-(pyrrolidine-1-carbonyl)-4,9-diazatricyclo[6.3.0.02,6]undeca-1(8),10-diene-3-carboxylate |
| SMILES | COC(=O)[C@@]1(Cc2ccc(OC)cc2)[C@H]2c3cc(C(=O)N4CCCC4)n(CCc4ccc(O)c(O)c4)c3C[C@H]2CN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C39H41N3O7/c1-48-29-13-10-26(11-14-29)23-39(38(47)49-2)35-28(24-42(39)36(45)27-8-4-3-5-9-27)21-31-30(35)22-32(37(46)40-17-6-7-18-40)41(31)19-16-25-12-15-33(43)34(44)20-25/h3-5,8-15,20,22,28,35,43-44H,6-7,16-19,21,23-24H2,1-2H3/t28-,35+,39+/m0/s1 |
| InChIKey | IOVKSLQPMLNGPI-SLPAIBBYSA-N |
| XLogP | 4.95 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.77 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|