C30H31FN2O6 — CID 3247157
methyl (3R,3aR,4S,6aR)-2-benzoyl-4-(2,3-dioxo-3-pyrrolidin-1-ylpropyl)-3-[(4-fluorophenyl)methyl]-5-oxo-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-3-carboxylate (PubChem CID 3247157) has the molecular formula C30H31FN2O6 and a molecular weight of 534.58 g/mol. Its IUPAC name is methyl (3R,3aR,4S,6aR)-2-benzoyl-4-(2,3-dioxo-3-pyrrolidin-1-ylpropyl)-3-[(4-fluorophenyl)methyl]-5-oxo-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-3-carboxylate.
| Compound Name | methyl (3R,3aR,4S,6aR)-2-benzoyl-4-(2,3-dioxo-3-pyrrolidin-1-ylpropyl)-3-[(4-fluorophenyl)methyl]-5-oxo-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 3247157 |
| Molecular Formula | C30H31FN2O6 |
| Molecular Weight | 534.58 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | methyl (3R,3aR,4S,6aR)-2-benzoyl-4-(2,3-dioxo-3-pyrrolidin-1-ylpropyl)-3-[(4-fluorophenyl)methyl]-5-oxo-3a,4,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@@]1(Cc2ccc(F)cc2)[C@@H]2[C@@H](CC(=O)[C@H]2CC(=O)C(=O)N2CCCC2)CN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C30H31FN2O6/c1-39-29(38)30(17-19-9-11-22(31)12-10-19)26-21(18-33(30)27(36)20-7-3-2-4-8-20)15-24(34)23(26)16-25(35)28(37)32-13-5-6-14-32/h2-4,7-12,21,23,26H,5-6,13-18H2,1H3/t21-,23+,26+,30+/m0/s1 |
| InChIKey | ADNFPHDFCQHUOV-XGQLODEDSA-N |
| XLogP | 2.84 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.58 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|