C35H41N3O6S — CID 3247198
methyl (2R,3R,6R)-4-benzoyl-9-[2-(2-hydroxyethylsulfanyl)ethyl]-3-[(4-methoxyphenyl)methyl]-10-(pyrrolidine-1-carbonyl)-4,9-diazatricyclo[6.3.0.02,6]undeca-1(8),10-diene-3-carboxylate (PubChem CID 3247198) has the molecular formula C35H41N3O6S and a molecular weight of 631.80 g/mol. Its IUPAC name is methyl (2R,3R,6R)-4-benzoyl-9-[2-(2-hydroxyethylsulfanyl)ethyl]-3-[(4-methoxyphenyl)methyl]-10-(pyrrolidine-1-carbonyl)-4,9-diazatricyclo[6.3.0.02,6]undeca-1(8),10-diene-3-carboxylate.
| Compound Name | methyl (2R,3R,6R)-4-benzoyl-9-[2-(2-hydroxyethylsulfanyl)ethyl]-3-[(4-methoxyphenyl)methyl]-10-(pyrrolidine-1-carbonyl)-4,9-diazatricyclo[6.3.0.02,6]undeca-1(8),10-diene-3-carboxylate |
|---|---|
| PubChem CID | 3247198 |
| Molecular Formula | C35H41N3O6S |
| Molecular Weight | 631.80 g/mol |
| Exact Mass | 631.27 |
| IUPAC Name | methyl (2R,3R,6R)-4-benzoyl-9-[2-(2-hydroxyethylsulfanyl)ethyl]-3-[(4-methoxyphenyl)methyl]-10-(pyrrolidine-1-carbonyl)-4,9-diazatricyclo[6.3.0.02,6]undeca-1(8),10-diene-3-carboxylate |
| SMILES | COC(=O)[C@@]1(Cc2ccc(OC)cc2)[C@H]2c3cc(C(=O)N4CCCC4)n(CCSCCO)c3C[C@H]2CN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C35H41N3O6S/c1-43-27-12-10-24(11-13-27)22-35(34(42)44-2)31-26(23-38(35)32(40)25-8-4-3-5-9-25)20-29-28(31)21-30(33(41)36-14-6-7-15-36)37(29)16-18-45-19-17-39/h3-5,8-13,21,26,31,39H,6-7,14-20,22-23H2,1-2H3/t26-,31+,35+/m0/s1 |
| InChIKey | IUIVVSQUZWZUMA-XRCYRVQWSA-N |
| XLogP | 4.02 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.80 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|