About trans-methyl (1S,2S)-2-[(S)-benzamido(phenyl)methyl]cyclopropane-1-carboxylate
trans-methyl (1S,2S)-2-[(S)-benzamido(phenyl)methyl]cyclopropane-1-carboxylate (PubChem CID 3247343) has the molecular formula C19H19NO3
and a molecular weight of 309.37 g/mol. Its IUPAC name is trans-methyl (1S,2S)-2-[(S)-benzamido(phenyl)methyl]cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | trans-methyl (1S,2S)-2-[(S)-benzamido(phenyl)methyl]cyclopropane-1-carboxylate |
| PubChem CID | 3247343 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | trans-methyl (1S,2S)-2-[(S)-benzamido(phenyl)methyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H]1[C@H](NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H19NO3/c1-23-19(22)16-12-15(16)17(13-8-4-2-5-9-13)20-18(21)14-10-6-3-7-11-14/h2-11,15-17H,12H2,1H3,(H,20,21)/t15-,16-,17+/m0/s1 |
| InChIKey | ACRQUHIUPAZNMP-YESZJQIVSA-N |
| XLogP | 2.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-methyl (1S,2S)-2-[(S)-benzamido(phenyl)methyl]cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-methyl (1S,2S)-2-[(S)-benzamido(phenyl)methyl]cyclopropane-1-carboxylate?
The IUPAC name of trans-methyl (1S,2S)-2-[(S)-benzamido(phenyl)methyl]cyclopropane-1-carboxylate (CID 3247343) is trans-methyl (1S,2S)-2-[(S)-benzamido(phenyl)methyl]cyclopropane-1-carboxylate.
What is the SMILES notation for trans-methyl (1S,2S)-2-[(S)-benzamido(phenyl)methyl]cyclopropane-1-carboxylate?
The canonical SMILES for trans-methyl (1S,2S)-2-[(S)-benzamido(phenyl)methyl]cyclopropane-1-carboxylate is COC(=O)[C@H]1C[C@@H]1[C@H](NC(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of trans-methyl (1S,2S)-2-[(S)-benzamido(phenyl)methyl]cyclopropane-1-carboxylate?
The InChIKey is ACRQUHIUPAZNMP-YESZJQIVSA-N. The full InChI is InChI=1S/C19H19NO3/c1-23-19(22)16-12-15(16)17(13-8-4-2-5-9-13)20-18(21)14-10-6-3-7-11-14/h2-11,15-17H,12H2,1H3,(H,20,21)/t15-,16-,17+/m0/s1.
What are the key properties of trans-methyl (1S,2S)-2-[(S)-benzamido(phenyl)methyl]cyclopropane-1-carboxylate?
trans-methyl (1S,2S)-2-[(S)-benzamido(phenyl)methyl]cyclopropane-1-carboxylate has a molecular weight of 309.37 g/mol, XLogP of 2.97, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-methyl (1S,2S)-2-[(S)-benzamido(phenyl)methyl]cyclopropane-1-carboxylate is sourced from PubChem (CID 3247343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).