About methyl 4-[(R)-benzamido-[(1R,2R)-2-butylcyclopropyl]methyl]benzoate
methyl 4-[(R)-benzamido-[(1R,2R)-2-butylcyclopropyl]methyl]benzoate (PubChem CID 3247412) has the molecular formula C23H27NO3
and a molecular weight of 365.47 g/mol. Its IUPAC name is methyl 4-[(R)-benzamido-[(1R,2R)-2-butylcyclopropyl]methyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[(R)-benzamido-[(1R,2R)-2-butylcyclopropyl]methyl]benzoate |
| PubChem CID | 3247412 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | methyl 4-[(R)-benzamido-[(1R,2R)-2-butylcyclopropyl]methyl]benzoate |
| SMILES | CCCC[C@@H]1C[C@H]1[C@@H](NC(=O)c1ccccc1)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C23H27NO3/c1-3-4-8-19-15-20(19)21(24-22(25)17-9-6-5-7-10-17)16-11-13-18(14-12-16)23(26)27-2/h5-7,9-14,19-21H,3-4,8,15H2,1-2H3,(H,24,25)/t19-,20-,21+/m1/s1 |
| InChIKey | ZMSDHYXFUJUMDA-NJYVYQBISA-N |
| XLogP | 4.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-[(R)-benzamido-[(1R,2R)-2-butylcyclopropyl]methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(R)-benzamido-[(1R,2R)-2-butylcyclopropyl]methyl]benzoate?
The IUPAC name of methyl 4-[(R)-benzamido-[(1R,2R)-2-butylcyclopropyl]methyl]benzoate (CID 3247412) is methyl 4-[(R)-benzamido-[(1R,2R)-2-butylcyclopropyl]methyl]benzoate.
What is the SMILES notation for methyl 4-[(R)-benzamido-[(1R,2R)-2-butylcyclopropyl]methyl]benzoate?
The canonical SMILES for methyl 4-[(R)-benzamido-[(1R,2R)-2-butylcyclopropyl]methyl]benzoate is CCCC[C@@H]1C[C@H]1[C@@H](NC(=O)c1ccccc1)c1ccc(C(=O)OC)cc1.
What is the InChIKey of methyl 4-[(R)-benzamido-[(1R,2R)-2-butylcyclopropyl]methyl]benzoate?
The InChIKey is ZMSDHYXFUJUMDA-NJYVYQBISA-N. The full InChI is InChI=1S/C23H27NO3/c1-3-4-8-19-15-20(19)21(24-22(25)17-9-6-5-7-10-17)16-11-13-18(14-12-16)23(26)27-2/h5-7,9-14,19-21H,3-4,8,15H2,1-2H3,(H,24,25)/t19-,20-,21+/m1/s1.
What are the key properties of methyl 4-[(R)-benzamido-[(1R,2R)-2-butylcyclopropyl]methyl]benzoate?
methyl 4-[(R)-benzamido-[(1R,2R)-2-butylcyclopropyl]methyl]benzoate has a molecular weight of 365.47 g/mol, XLogP of 4.77, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(R)-benzamido-[(1R,2R)-2-butylcyclopropyl]methyl]benzoate is sourced from PubChem (CID 3247412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).