C15H15N2OS2+ — CID 3247858
7-phenyl-6-thiophen-2-yl-3,5-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-6-ol (PubChem CID 3247858) has the molecular formula C15H15N2OS2+ and a molecular weight of 303.43 g/mol. Its IUPAC name is 7-phenyl-6-thiophen-2-yl-3,5-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-6-ol.
| Compound Name | 7-phenyl-6-thiophen-2-yl-3,5-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-6-ol |
|---|---|
| PubChem CID | 3247858 |
| Molecular Formula | C15H15N2OS2+ |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 7-phenyl-6-thiophen-2-yl-3,5-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-6-ol |
| SMILES | OC1(c2cccs2)C[N+]2=C(SCC2)N1c1ccccc1 |
| InChI | InChI=1S/C15H15N2OS2/c18-15(13-7-4-9-19-13)11-16-8-10-20-14(16)17(15)12-5-2-1-3-6-12/h1-7,9,18H,8,10-11H2/q+1 |
| InChIKey | GDGGIRIGMGBJQL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|