C19H22F3N7S — CID 3248059
2-N,2-N,4-N,4-N-tetramethyl-6-[4-methyl-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazol-3-yl]pyrimidine-2,4-diamine (PubChem CID 3248059) has the molecular formula C19H22F3N7S and a molecular weight of 437.50 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N-tetramethyl-6-[4-methyl-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazol-3-yl]pyrimidine-2,4-diamine.
| Compound Name | 2-N,2-N,4-N,4-N-tetramethyl-6-[4-methyl-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazol-3-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 3248059 |
| Molecular Formula | C19H22F3N7S |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 2-N,2-N,4-N,4-N-tetramethyl-6-[4-methyl-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazol-3-yl]pyrimidine-2,4-diamine |
| SMILES | CN(C)c1cc(-c2nnc(SCc3cccc(C(F)(F)F)c3)n2C)nc(N(C)C)n1 |
| InChI | InChI=1S/C19H22F3N7S/c1-27(2)15-10-14(23-17(24-15)28(3)4)16-25-26-18(29(16)5)30-11-12-7-6-8-13(9-12)19(20,21)22/h6-10H,11H2,1-5H3 |
| InChIKey | YXFSBCSULHWBEA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |