C27H39N2O3+ — CID 3248522
5-[[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one (PubChem CID 3248522) has the molecular formula C27H39N2O3+ and a molecular weight of 439.62 g/mol. Its IUPAC name is 5-[[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one.
| Compound Name | 5-[[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
|---|---|
| PubChem CID | 3248522 |
| Molecular Formula | C27H39N2O3+ |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.30 |
| IUPAC Name | 5-[[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
| SMILES | Cc1cccc(N2CC[NH+](CC3C(=O)OC4CC5(C)CCCC(C)C56OC6C43)CC2)c1C |
| InChI | InChI=1S/C27H38N2O3/c1-17-7-5-9-21(19(17)3)29-13-11-28(12-14-29)16-20-23-22(31-25(20)30)15-26(4)10-6-8-18(2)27(26)24(23)32-27/h5,7,9,18,20,22-24H,6,8,10-16H2,1-4H3/p+1 |
| InChIKey | HBYHOCYVPJTQJN-UHFFFAOYSA-O |
| XLogP | 2.53 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|