C16H24N4O2 — CID 3248794
6-[6-aminohexyl(ethyl)amino]-2,3-dihydrophthalazine-1,4-dione (PubChem CID 3248794) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 6-[6-aminohexyl(ethyl)amino]-2,3-dihydrophthalazine-1,4-dione.
| Compound Name | 6-[6-aminohexyl(ethyl)amino]-2,3-dihydrophthalazine-1,4-dione |
|---|---|
| PubChem CID | 3248794 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 6-[6-aminohexyl(ethyl)amino]-2,3-dihydrophthalazine-1,4-dione |
| SMILES | CCN(CCCCCCN)c1ccc2c(=O)[nH][nH]c(=O)c2c1 |
| InChI | InChI=1S/C16H24N4O2/c1-2-20(10-6-4-3-5-9-17)12-7-8-13-14(11-12)16(22)19-18-15(13)21/h7-8,11H,2-6,9-10,17H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | BEADQYOTAORBKI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|