About [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-phenylpropanoate
[6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-phenylpropanoate (PubChem CID 3249465) has the molecular formula C20H15ClN4O3
and a molecular weight of 394.82 g/mol. Its IUPAC name is [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-phenylpropanoate.
Molecular Properties
| Compound Name | [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-phenylpropanoate |
| PubChem CID | 3249465 |
| Molecular Formula | C20H15ClN4O3 |
| Molecular Weight | 394.82 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-phenylpropanoate |
| SMILES | O=C(CCc1ccccc1)OC1c2nccnc2C(=O)N1c1ccc(Cl)cn1 |
| InChI | InChI=1S/C20H15ClN4O3/c21-14-7-8-15(24-12-14)25-19(27)17-18(23-11-10-22-17)20(25)28-16(26)9-6-13-4-2-1-3-5-13/h1-5,7-8,10-12,20H,6,9H2 |
| InChIKey | MOJXFWQCHXNWPW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 85.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.82 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-phenylpropanoate?
The IUPAC name of [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-phenylpropanoate (CID 3249465) is [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-phenylpropanoate.
What is the SMILES notation for [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-phenylpropanoate?
The canonical SMILES for [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-phenylpropanoate is O=C(CCc1ccccc1)OC1c2nccnc2C(=O)N1c1ccc(Cl)cn1.
What is the InChIKey of [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-phenylpropanoate?
The InChIKey is MOJXFWQCHXNWPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15ClN4O3/c21-14-7-8-15(24-12-14)25-19(27)17-18(23-11-10-22-17)20(25)28-16(26)9-6-13-4-2-1-3-5-13/h1-5,7-8,10-12,20H,6,9H2.
What are the key properties of [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-phenylpropanoate?
[6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-phenylpropanoate has a molecular weight of 394.82 g/mol, XLogP of 3.36, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] 3-phenylpropanoate is sourced from PubChem (CID 3249465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).