C19H25ClN4O — CID 3249876
3-chloro-7-cyclohexyl-1-morpholin-4-yl-6,8-dihydro-5H-2,7-naphthyridine-4-carbonitrile (PubChem CID 3249876) has the molecular formula C19H25ClN4O and a molecular weight of 360.89 g/mol. Its IUPAC name is 3-chloro-7-cyclohexyl-1-morpholin-4-yl-6,8-dihydro-5H-2,7-naphthyridine-4-carbonitrile.
| Compound Name | 3-chloro-7-cyclohexyl-1-morpholin-4-yl-6,8-dihydro-5H-2,7-naphthyridine-4-carbonitrile |
|---|---|
| PubChem CID | 3249876 |
| Molecular Formula | C19H25ClN4O |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 3-chloro-7-cyclohexyl-1-morpholin-4-yl-6,8-dihydro-5H-2,7-naphthyridine-4-carbonitrile |
| SMILES | N#Cc1c(Cl)nc(N2CCOCC2)c2c1CCN(C1CCCCC1)C2 |
| InChI | InChI=1S/C19H25ClN4O/c20-18-16(12-21)15-6-7-24(14-4-2-1-3-5-14)13-17(15)19(22-18)23-8-10-25-11-9-23/h14H,1-11,13H2 |
| InChIKey | MRWDGQDWOVCQPV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 52.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|