C22H26FN3O3S2 — CID 3249964
N,N-diethyl-4-[2-(4-fluorophenyl)imino-3-(3-hydroxypropyl)-1,3-thiazol-4-yl]benzenesulfonamide (PubChem CID 3249964) has the molecular formula C22H26FN3O3S2 and a molecular weight of 463.60 g/mol. Its IUPAC name is N,N-diethyl-4-[2-(4-fluorophenyl)imino-3-(3-hydroxypropyl)-1,3-thiazol-4-yl]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[2-(4-fluorophenyl)imino-3-(3-hydroxypropyl)-1,3-thiazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3249964 |
| Molecular Formula | C22H26FN3O3S2 |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | N,N-diethyl-4-[2-(4-fluorophenyl)imino-3-(3-hydroxypropyl)-1,3-thiazol-4-yl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(-c2cs/c(=N\c3ccc(F)cc3)n2CCCO)cc1 |
| InChI | InChI=1S/C22H26FN3O3S2/c1-3-25(4-2)31(28,29)20-12-6-17(7-13-20)21-16-30-22(26(21)14-5-15-27)24-19-10-8-18(23)9-11-19/h6-13,16,27H,3-5,14-15H2,1-2H3/b24-22- |
| InChIKey | FHTAJYDIZMSMHS-GYHWCHFESA-N |
| XLogP | 4.00 |
| TPSA | 74.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|