C19H22ClNO3 — CID 3249970
4-chloro-2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)phenol (PubChem CID 3249970) has the molecular formula C19H22ClNO3 and a molecular weight of 347.84 g/mol. Its IUPAC name is 4-chloro-2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)phenol.
| Compound Name | 4-chloro-2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)phenol |
|---|---|
| PubChem CID | 3249970 |
| Molecular Formula | C19H22ClNO3 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 4-chloro-2-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)phenol |
| SMILES | CCOc1cc2c(cc1OCC)C(c1cc(Cl)ccc1O)NCC2 |
| InChI | InChI=1S/C19H22ClNO3/c1-3-23-17-9-12-7-8-21-19(14(12)11-18(17)24-4-2)15-10-13(20)5-6-16(15)22/h5-6,9-11,19,21-22H,3-4,7-8H2,1-2H3 |
| InChIKey | BCFBJGOOAHACFI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|