C15H23N3O3S — CID 32502208
N,N-dimethyl-4-(3-phenylpropanoyl)piperazine-1-sulfonamide (PubChem CID 32502208) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is N,N-dimethyl-4-(3-phenylpropanoyl)piperazine-1-sulfonamide.
| Compound Name | N,N-dimethyl-4-(3-phenylpropanoyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 32502208 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N,N-dimethyl-4-(3-phenylpropanoyl)piperazine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCN(C(=O)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C15H23N3O3S/c1-16(2)22(20,21)18-12-10-17(11-13-18)15(19)9-8-14-6-4-3-5-7-14/h3-7H,8-13H2,1-2H3 |
| InChIKey | CDRHPOSRDILQEJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |