C24H24Cl2N4O3S — CID 3250689
6,7-dichloro-12,15,15-trimethyl-N'-(4-methylphenyl)sulfonyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carbohydrazide (PubChem CID 3250689) has the molecular formula C24H24Cl2N4O3S and a molecular weight of 519.45 g/mol. Its IUPAC name is 6,7-dichloro-12,15,15-trimethyl-N'-(4-methylphenyl)sulfonyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carbohydrazide.
| Compound Name | 6,7-dichloro-12,15,15-trimethyl-N'-(4-methylphenyl)sulfonyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carbohydrazide |
|---|---|
| PubChem CID | 3250689 |
| Molecular Formula | C24H24Cl2N4O3S |
| Molecular Weight | 519.45 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | 6,7-dichloro-12,15,15-trimethyl-N'-(4-methylphenyl)sulfonyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carbohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)C23CCC(C)(c4nc5cc(Cl)c(Cl)cc5nc42)C3(C)C)cc1 |
| InChI | InChI=1S/C24H24Cl2N4O3S/c1-13-5-7-14(8-6-13)34(32,33)30-29-21(31)24-10-9-23(4,22(24,2)3)19-20(24)28-18-12-16(26)15(25)11-17(18)27-19/h5-8,11-12,30H,9-10H2,1-4H3,(H,29,31) |
| InChIKey | APQCAJDWXLVRHJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|