C17H14N4O2S — CID 3250779
3-[(1H-indol-3-ylmethylideneamino)carbamothioylamino]benzoic acid (PubChem CID 3250779) has the molecular formula C17H14N4O2S and a molecular weight of 338.39 g/mol. Its IUPAC name is 3-[(1H-indol-3-ylmethylideneamino)carbamothioylamino]benzoic acid.
| Compound Name | 3-[(1H-indol-3-ylmethylideneamino)carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 3250779 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 3-[(1H-indol-3-ylmethylideneamino)carbamothioylamino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=S)NN=Cc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C17H14N4O2S/c22-16(23)11-4-3-5-13(8-11)20-17(24)21-19-10-12-9-18-15-7-2-1-6-14(12)15/h1-10,18H,(H,22,23)(H2,20,21,24) |
| InChIKey | DBRQBWCMOARKQF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_I(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|