About 5-oxododecanoic acid
5-oxododecanoic acid (PubChem CID 3250790) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is 5-oxododecanoic acid.
Molecular Properties
| Compound Name | 5-oxododecanoic acid |
| PubChem CID | 3250790 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 5-oxododecanoic acid |
| SMILES | CCCCCCCC(=O)CCCC(=O)O |
| InChI | InChI=1S/C12H22O3/c1-2-3-4-5-6-8-11(13)9-7-10-12(14)15/h2-10H2,1H3,(H,14,15) |
| InChIKey | WTQMFERWXACENH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-oxododecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxododecanoic acid?
The IUPAC name of 5-oxododecanoic acid (CID 3250790) is 5-oxododecanoic acid.
What is the SMILES notation for 5-oxododecanoic acid?
The canonical SMILES for 5-oxododecanoic acid is CCCCCCCC(=O)CCCC(=O)O.
What is the InChIKey of 5-oxododecanoic acid?
The InChIKey is WTQMFERWXACENH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3/c1-2-3-4-5-6-8-11(13)9-7-10-12(14)15/h2-10H2,1H3,(H,14,15).
What are the key properties of 5-oxododecanoic acid?
5-oxododecanoic acid has a molecular weight of 214.30 g/mol, XLogP of 3.17, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxododecanoic acid is sourced from PubChem (CID 3250790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).