C14H17IN4O2S — CID 32508355
2-[(4-butyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(3-iodophenyl)acetamide (PubChem CID 32508355) has the molecular formula C14H17IN4O2S and a molecular weight of 432.29 g/mol. Its IUPAC name is 2-[(4-butyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(3-iodophenyl)acetamide.
| Compound Name | 2-[(4-butyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(3-iodophenyl)acetamide |
|---|---|
| PubChem CID | 32508355 |
| Molecular Formula | C14H17IN4O2S |
| Molecular Weight | 432.29 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | 2-[(4-butyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(3-iodophenyl)acetamide |
| SMILES | CCCCn1c(SCC(=O)Nc2cccc(I)c2)n[nH]c1=O |
| InChI | InChI=1S/C14H17IN4O2S/c1-2-3-7-19-13(21)17-18-14(19)22-9-12(20)16-11-6-4-5-10(15)8-11/h4-6,8H,2-3,7,9H2,1H3,(H,16,20)(H,17,21) |
| InChIKey | SWIOXVWXLIAJKK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|