About 4,4-dimethyl-5-phenyl-2,3-dihydropyrrol-2-ol
4,4-dimethyl-5-phenyl-2,3-dihydropyrrol-2-ol (PubChem CID 3251128) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is 4,4-dimethyl-5-phenyl-2,3-dihydropyrrol-2-ol.
Molecular Properties
| Compound Name | 4,4-dimethyl-5-phenyl-2,3-dihydropyrrol-2-ol |
| PubChem CID | 3251128 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 4,4-dimethyl-5-phenyl-2,3-dihydropyrrol-2-ol |
| SMILES | CC1(C)CC(O)N=C1c1ccccc1 |
| InChI | InChI=1S/C12H15NO/c1-12(2)8-10(14)13-11(12)9-6-4-3-5-7-9/h3-7,10,14H,8H2,1-2H3 |
| InChIKey | ODBSLZVFGWJRFE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,4-dimethyl-5-phenyl-2,3-dihydropyrrol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-5-phenyl-2,3-dihydropyrrol-2-ol?
The IUPAC name of 4,4-dimethyl-5-phenyl-2,3-dihydropyrrol-2-ol (CID 3251128) is 4,4-dimethyl-5-phenyl-2,3-dihydropyrrol-2-ol.
What is the SMILES notation for 4,4-dimethyl-5-phenyl-2,3-dihydropyrrol-2-ol?
The canonical SMILES for 4,4-dimethyl-5-phenyl-2,3-dihydropyrrol-2-ol is CC1(C)CC(O)N=C1c1ccccc1.
What is the InChIKey of 4,4-dimethyl-5-phenyl-2,3-dihydropyrrol-2-ol?
The InChIKey is ODBSLZVFGWJRFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO/c1-12(2)8-10(14)13-11(12)9-6-4-3-5-7-9/h3-7,10,14H,8H2,1-2H3.
What are the key properties of 4,4-dimethyl-5-phenyl-2,3-dihydropyrrol-2-ol?
4,4-dimethyl-5-phenyl-2,3-dihydropyrrol-2-ol has a molecular weight of 189.26 g/mol, XLogP of 2.22, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-5-phenyl-2,3-dihydropyrrol-2-ol is sourced from PubChem (CID 3251128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).