About 6-bromo-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)quinazoline
6-bromo-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)quinazoline (PubChem CID 3252078) has the molecular formula C18H22BrN3
and a molecular weight of 360.30 g/mol. Its IUPAC name is 6-bromo-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)quinazoline.
Molecular Properties
| Compound Name | 6-bromo-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)quinazoline |
| PubChem CID | 3252078 |
| Molecular Formula | C18H22BrN3 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 6-bromo-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)quinazoline |
| SMILES | CC1(C)CC2CC(C)(CN2c2ncnc3ccc(Br)cc23)C1 |
| InChI | InChI=1S/C18H22BrN3/c1-17(2)7-13-8-18(3,9-17)10-22(13)16-14-6-12(19)4-5-15(14)20-11-21-16/h4-6,11,13H,7-10H2,1-3H3 |
| InChIKey | NNEVMBDBIWBOIP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)quinazoline?
The IUPAC name of 6-bromo-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)quinazoline (CID 3252078) is 6-bromo-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)quinazoline.
What is the SMILES notation for 6-bromo-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)quinazoline?
The canonical SMILES for 6-bromo-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)quinazoline is CC1(C)CC2CC(C)(CN2c2ncnc3ccc(Br)cc23)C1.
What is the InChIKey of 6-bromo-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)quinazoline?
The InChIKey is NNEVMBDBIWBOIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22BrN3/c1-17(2)7-13-8-18(3,9-17)10-22(13)16-14-6-12(19)4-5-15(14)20-11-21-16/h4-6,11,13H,7-10H2,1-3H3.
What are the key properties of 6-bromo-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)quinazoline?
6-bromo-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)quinazoline has a molecular weight of 360.30 g/mol, XLogP of 4.80, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)quinazoline is sourced from PubChem (CID 3252078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).