C24H22Cl2N2O2 — CID 3252138
(4-methylphenyl) 6,7-dichloro-12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxylate (PubChem CID 3252138) has the molecular formula C24H22Cl2N2O2 and a molecular weight of 441.36 g/mol. Its IUPAC name is (4-methylphenyl) 6,7-dichloro-12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxylate.
| Compound Name | (4-methylphenyl) 6,7-dichloro-12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxylate |
|---|---|
| PubChem CID | 3252138 |
| Molecular Formula | C24H22Cl2N2O2 |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | (4-methylphenyl) 6,7-dichloro-12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4,6,8,10-pentaene-1-carboxylate |
| SMILES | Cc1ccc(OC(=O)C23CCC(C)(c4nc5cc(Cl)c(Cl)cc5nc42)C3(C)C)cc1 |
| InChI | InChI=1S/C24H22Cl2N2O2/c1-13-5-7-14(8-6-13)30-21(29)24-10-9-23(4,22(24,2)3)19-20(24)28-18-12-16(26)15(25)11-17(18)27-19/h5-8,11-12H,9-10H2,1-4H3 |
| InChIKey | FCMUMHOKHQEIII-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|