C29H28N2O2 — CID 3252150
naphthalen-1-yl 6,7,12,15,15-pentamethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxylate (PubChem CID 3252150) has the molecular formula C29H28N2O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is naphthalen-1-yl 6,7,12,15,15-pentamethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxylate.
| Compound Name | naphthalen-1-yl 6,7,12,15,15-pentamethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxylate |
|---|---|
| PubChem CID | 3252150 |
| Molecular Formula | C29H28N2O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | naphthalen-1-yl 6,7,12,15,15-pentamethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-1-carboxylate |
| SMILES | Cc1cc2nc3c(nc2cc1C)C1(C(=O)Oc2cccc4ccccc24)CCC3(C)C1(C)C |
| InChI | InChI=1S/C29H28N2O2/c1-17-15-21-22(16-18(17)2)31-25-24(30-21)28(5)13-14-29(25,27(28,3)4)26(32)33-23-12-8-10-19-9-6-7-11-20(19)23/h6-12,15-16H,13-14H2,1-5H3 |
| InChIKey | JRHAUKZAZSTTDW-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|