C23H23N3O4 — CID 3252781
2-N,5-N-bis(4-ethoxyphenyl)pyridine-2,5-dicarboxamide (PubChem CID 3252781) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is 2-N,5-N-bis(4-ethoxyphenyl)pyridine-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis(4-ethoxyphenyl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 3252781 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 2-N,5-N-bis(4-ethoxyphenyl)pyridine-2,5-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(C(=O)Nc3ccc(OCC)cc3)nc2)cc1 |
| InChI | InChI=1S/C23H23N3O4/c1-3-29-19-10-6-17(7-11-19)25-22(27)16-5-14-21(24-15-16)23(28)26-18-8-12-20(13-9-18)30-4-2/h5-15H,3-4H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | FUIQISMCIDJNPY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |