About O-(2,3-dimethylquinoxalin-6-yl) N-phenyl-N-prop-2-enylcarbamothioate
O-(2,3-dimethylquinoxalin-6-yl) N-phenyl-N-prop-2-enylcarbamothioate (PubChem CID 3252911) has the molecular formula C20H19N3OS
and a molecular weight of 349.46 g/mol. Its IUPAC name is O-(2,3-dimethylquinoxalin-6-yl) N-phenyl-N-prop-2-enylcarbamothioate.
Molecular Properties
| Compound Name | O-(2,3-dimethylquinoxalin-6-yl) N-phenyl-N-prop-2-enylcarbamothioate |
| PubChem CID | 3252911 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | O-(2,3-dimethylquinoxalin-6-yl) N-phenyl-N-prop-2-enylcarbamothioate |
| SMILES | C=CCN(C(=S)Oc1ccc2nc(C)c(C)nc2c1)c1ccccc1 |
| InChI | InChI=1S/C20H19N3OS/c1-4-12-23(16-8-6-5-7-9-16)20(25)24-17-10-11-18-19(13-17)22-15(3)14(2)21-18/h4-11,13H,1,12H2,2-3H3 |
| InChIKey | GXJTYQAPMFNBRN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(2,3-dimethylquinoxalin-6-yl) N-phenyl-N-prop-2-enylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(2,3-dimethylquinoxalin-6-yl) N-phenyl-N-prop-2-enylcarbamothioate?
The IUPAC name of O-(2,3-dimethylquinoxalin-6-yl) N-phenyl-N-prop-2-enylcarbamothioate (CID 3252911) is O-(2,3-dimethylquinoxalin-6-yl) N-phenyl-N-prop-2-enylcarbamothioate.
What is the SMILES notation for O-(2,3-dimethylquinoxalin-6-yl) N-phenyl-N-prop-2-enylcarbamothioate?
The canonical SMILES for O-(2,3-dimethylquinoxalin-6-yl) N-phenyl-N-prop-2-enylcarbamothioate is C=CCN(C(=S)Oc1ccc2nc(C)c(C)nc2c1)c1ccccc1.
What is the InChIKey of O-(2,3-dimethylquinoxalin-6-yl) N-phenyl-N-prop-2-enylcarbamothioate?
The InChIKey is GXJTYQAPMFNBRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3OS/c1-4-12-23(16-8-6-5-7-9-16)20(25)24-17-10-11-18-19(13-17)22-15(3)14(2)21-18/h4-11,13H,1,12H2,2-3H3.
What are the key properties of O-(2,3-dimethylquinoxalin-6-yl) N-phenyl-N-prop-2-enylcarbamothioate?
O-(2,3-dimethylquinoxalin-6-yl) N-phenyl-N-prop-2-enylcarbamothioate has a molecular weight of 349.46 g/mol, XLogP of 4.60, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-(2,3-dimethylquinoxalin-6-yl) N-phenyl-N-prop-2-enylcarbamothioate is sourced from PubChem (CID 3252911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).