About 4-(2-methoxyethyl)-3,5-dimethyl-1H-pyrazole
4-(2-methoxyethyl)-3,5-dimethyl-1H-pyrazole (PubChem CID 3253096) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 4-(2-methoxyethyl)-3,5-dimethyl-1H-pyrazole.
Molecular Properties
| Compound Name | 4-(2-methoxyethyl)-3,5-dimethyl-1H-pyrazole |
| PubChem CID | 3253096 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 4-(2-methoxyethyl)-3,5-dimethyl-1H-pyrazole |
| SMILES | COCCc1c(C)n[nH]c1C |
| InChI | InChI=1S/C8H14N2O/c1-6-8(4-5-11-3)7(2)10-9-6/h4-5H2,1-3H3,(H,9,10) |
| InChIKey | HKXRIKCCQBEKDA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-methoxyethyl)-3,5-dimethyl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methoxyethyl)-3,5-dimethyl-1H-pyrazole?
The IUPAC name of 4-(2-methoxyethyl)-3,5-dimethyl-1H-pyrazole (CID 3253096) is 4-(2-methoxyethyl)-3,5-dimethyl-1H-pyrazole.
What is the SMILES notation for 4-(2-methoxyethyl)-3,5-dimethyl-1H-pyrazole?
The canonical SMILES for 4-(2-methoxyethyl)-3,5-dimethyl-1H-pyrazole is COCCc1c(C)n[nH]c1C.
What is the InChIKey of 4-(2-methoxyethyl)-3,5-dimethyl-1H-pyrazole?
The InChIKey is HKXRIKCCQBEKDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c1-6-8(4-5-11-3)7(2)10-9-6/h4-5H2,1-3H3,(H,9,10).
What are the key properties of 4-(2-methoxyethyl)-3,5-dimethyl-1H-pyrazole?
4-(2-methoxyethyl)-3,5-dimethyl-1H-pyrazole has a molecular weight of 154.21 g/mol, XLogP of 1.22, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methoxyethyl)-3,5-dimethyl-1H-pyrazole is sourced from PubChem (CID 3253096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).