C22H28N2O3 — CID 32532383
3-(4-tert-butylphenyl)-1-[4-(furan-3-carbonyl)piperazin-1-yl]propan-1-one (PubChem CID 32532383) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-1-[4-(furan-3-carbonyl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-(4-tert-butylphenyl)-1-[4-(furan-3-carbonyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 32532383 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 3-(4-tert-butylphenyl)-1-[4-(furan-3-carbonyl)piperazin-1-yl]propan-1-one |
| SMILES | CC(C)(C)c1ccc(CCC(=O)N2CCN(C(=O)c3ccoc3)CC2)cc1 |
| InChI | InChI=1S/C22H28N2O3/c1-22(2,3)19-7-4-17(5-8-19)6-9-20(25)23-11-13-24(14-12-23)21(26)18-10-15-27-16-18/h4-5,7-8,10,15-16H,6,9,11-14H2,1-3H3 |
| InChIKey | ZACAQHPNRYARJX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |