C21H23ClN4O3S — CID 3253270
N-(4-chlorophenyl)-2-[4-ethyl-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]acetamide (PubChem CID 3253270) has the molecular formula C21H23ClN4O3S and a molecular weight of 446.96 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[4-ethyl-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[4-ethyl-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]acetamide |
|---|---|
| PubChem CID | 3253270 |
| Molecular Formula | C21H23ClN4O3S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | N-(4-chlorophenyl)-2-[4-ethyl-5-[2-(4-methoxyphenoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]acetamide |
| SMILES | CCn1c(CC(=O)Nc2ccc(Cl)cc2)nnc1SCCOc1ccc(OC)cc1 |
| InChI | InChI=1S/C21H23ClN4O3S/c1-3-26-19(14-20(27)23-16-6-4-15(22)5-7-16)24-25-21(26)30-13-12-29-18-10-8-17(28-2)9-11-18/h4-11H,3,12-14H2,1-2H3,(H,23,27) |
| InChIKey | ODWWHUAHEGVTQD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|