C15H13F13N4O — CID 3253295
N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide (PubChem CID 3253295) has the molecular formula C15H13F13N4O and a molecular weight of 512.27 g/mol. Its IUPAC name is N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide.
| Compound Name | N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide |
|---|---|
| PubChem CID | 3253295 |
| Molecular Formula | C15H13F13N4O |
| Molecular Weight | 512.27 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide |
| SMILES | CCn1nc(C)c(C=NNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1C |
| InChI | InChI=1S/C15H13F13N4O/c1-4-32-7(3)8(6(2)31-32)5-29-30-9(33)10(16,17)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h5H,4H2,1-3H3,(H,30,33) |
| InChIKey | ZRAMXZNINKKYLS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.27 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|