About (2S)-2-[(4-oxothieno[3,2-d]pyrimidin-3-yl)methyl]pentanedinitrile
(2S)-2-[(4-oxothieno[3,2-d]pyrimidin-3-yl)methyl]pentanedinitrile (PubChem CID 32534091) has the molecular formula C12H10N4OS
and a molecular weight of 258.31 g/mol. Its IUPAC name is (2S)-2-[(4-oxothieno[3,2-d]pyrimidin-3-yl)methyl]pentanedinitrile.
Molecular Properties
| Compound Name | (2S)-2-[(4-oxothieno[3,2-d]pyrimidin-3-yl)methyl]pentanedinitrile |
| PubChem CID | 32534091 |
| Molecular Formula | C12H10N4OS |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | (2S)-2-[(4-oxothieno[3,2-d]pyrimidin-3-yl)methyl]pentanedinitrile |
| SMILES | N#CCC[C@H](C#N)Cn1cnc2ccsc2c1=O |
| InChI | InChI=1S/C12H10N4OS/c13-4-1-2-9(6-14)7-16-8-15-10-3-5-18-11(10)12(16)17/h3,5,8-9H,1-2,7H2/t9-/m1/s1 |
| InChIKey | XTLMGAFLMSMNIR-SECBINFHSA-N |
| XLogP | 1.90 |
| TPSA | 82.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2S)-2-[(4-oxothieno[3,2-d]pyrimidin-3-yl)methyl]pentanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(4-oxothieno[3,2-d]pyrimidin-3-yl)methyl]pentanedinitrile?
The IUPAC name of (2S)-2-[(4-oxothieno[3,2-d]pyrimidin-3-yl)methyl]pentanedinitrile (CID 32534091) is (2S)-2-[(4-oxothieno[3,2-d]pyrimidin-3-yl)methyl]pentanedinitrile.
What is the SMILES notation for (2S)-2-[(4-oxothieno[3,2-d]pyrimidin-3-yl)methyl]pentanedinitrile?
The canonical SMILES for (2S)-2-[(4-oxothieno[3,2-d]pyrimidin-3-yl)methyl]pentanedinitrile is N#CCC[C@H](C#N)Cn1cnc2ccsc2c1=O.
What is the InChIKey of (2S)-2-[(4-oxothieno[3,2-d]pyrimidin-3-yl)methyl]pentanedinitrile?
The InChIKey is XTLMGAFLMSMNIR-SECBINFHSA-N. The full InChI is InChI=1S/C12H10N4OS/c13-4-1-2-9(6-14)7-16-8-15-10-3-5-18-11(10)12(16)17/h3,5,8-9H,1-2,7H2/t9-/m1/s1.
What are the key properties of (2S)-2-[(4-oxothieno[3,2-d]pyrimidin-3-yl)methyl]pentanedinitrile?
(2S)-2-[(4-oxothieno[3,2-d]pyrimidin-3-yl)methyl]pentanedinitrile has a molecular weight of 258.31 g/mol, XLogP of 1.90, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(4-oxothieno[3,2-d]pyrimidin-3-yl)methyl]pentanedinitrile is sourced from PubChem (CID 32534091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).