C24H22N4O4 — CID 32538830
1-benzofuran-2-yl-[4-(4-methoxy-1-phenylpyrazole-3-carbonyl)piperazin-1-yl]methanone (PubChem CID 32538830) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is 1-benzofuran-2-yl-[4-(4-methoxy-1-phenylpyrazole-3-carbonyl)piperazin-1-yl]methanone.
| Compound Name | 1-benzofuran-2-yl-[4-(4-methoxy-1-phenylpyrazole-3-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 32538830 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 1-benzofuran-2-yl-[4-(4-methoxy-1-phenylpyrazole-3-carbonyl)piperazin-1-yl]methanone |
| SMILES | COc1cn(-c2ccccc2)nc1C(=O)N1CCN(C(=O)c2cc3ccccc3o2)CC1 |
| InChI | InChI=1S/C24H22N4O4/c1-31-21-16-28(18-8-3-2-4-9-18)25-22(21)24(30)27-13-11-26(12-14-27)23(29)20-15-17-7-5-6-10-19(17)32-20/h2-10,15-16H,11-14H2,1H3 |
| InChIKey | YFFGLCDRDZGGSE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 80.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |