About 2-hydroxyethylthiourea
2-hydroxyethylthiourea (PubChem CID 3254090) has the molecular formula C3H8N2OS
and a molecular weight of 120.18 g/mol. Its IUPAC name is 2-hydroxyethylthiourea.
Molecular Properties
| Compound Name | 2-hydroxyethylthiourea |
| PubChem CID | 3254090 |
| Molecular Formula | C3H8N2OS |
| Molecular Weight | 120.18 g/mol |
| Exact Mass | 120.04 |
| IUPAC Name | 2-hydroxyethylthiourea |
| SMILES | NC(=S)NCCO |
| InChI | InChI=1S/C3H8N2OS/c4-3(7)5-1-2-6/h6H,1-2H2,(H3,4,5,7) |
| InChIKey | IPSVDERFJPMANL-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.18 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethylthiourea?
The IUPAC name of 2-hydroxyethylthiourea (CID 3254090) is 2-hydroxyethylthiourea.
What is the SMILES notation for 2-hydroxyethylthiourea?
The canonical SMILES for 2-hydroxyethylthiourea is NC(=S)NCCO.
What is the InChIKey of 2-hydroxyethylthiourea?
The InChIKey is IPSVDERFJPMANL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2OS/c4-3(7)5-1-2-6/h6H,1-2H2,(H3,4,5,7).
What are the key properties of 2-hydroxyethylthiourea?
2-hydroxyethylthiourea has a molecular weight of 120.18 g/mol, XLogP of -1.19, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethylthiourea is sourced from PubChem (CID 3254090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).